4368-06-3 3-Hydroxybutyronitrile
| termék neve |
3-Hydroxybutyronitrile |
| Angol név |
3-Hydroxybutyronitrile;beta-Hydroxybutyronitrile; 3-hydroxybutanenitrile |
| MF |
C4H7NO |
| Molekulat?meg |
85.1045 |
| InChI |
InChI=1/C4H7NO/c1-4(6)2-3-5/h4,6H,2H2,1H3 |
| CAS-szám |
4368-06-3 |
| EINECS |
224-457-2 |
| Molekuláris szerkezete |
|
| S?r?ség |
0.991g/cm3 |
| Forráspont |
217.3°C at 760 mmHg |
| T?résmutató |
1.425 |
| Gyulladáspont |
85.2°C |
| G?znyomás |
0.0286mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|