ChemNet > CAS > 38939-88-7 3-Chloro-4-nitrotoluene
38939-88-7 3-Chloro-4-nitrotoluene
| Ονομασ?α του προ??ντο? |
3-Chloro-4-nitrotoluene |
| Αγγλικ? ?νομα |
3-Chloro-4-nitrotoluene;2-chloro-4-methyl-1-nitrobenzene |
| MF |
C7H6ClNO2 |
| Μοριακ? β?ρο? |
171.581 |
| InChI |
InChI=1/C7H6ClNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| CAS ΟΧΙ |
38939-88-7 |
| EINECS |
254-199-6 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.324g/cm3 |
| Σημε?ο τ?ξη? |
22-27℃ |
| Σημε?ο βρασμο? |
273.4°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.57 |
| Σημε?ο αν?φλεξη? |
119.1°C |
| Π?εση ατμ?ν |
0.00962mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|