85-29-0 2,4'-Dichlorobenzophenone
| product Name |
2,4'-Dichlorobenzophenone |
| CAS No |
85-29-0 |
| Synonyms |
Dichlorobenzophenone |
| Molecular Formula |
C13H8Cl2O |
| Molecular Weight |
251.11 |
| InChI |
InChI=1/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H |
| EINECS |
201-596-7 |
| Molecular Structure |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Chang Cheng; Yan Zhenyu |
| Telephone |
+86-25-58392388-600 |
| Email |
yanliuxin@sinohighchem.com |
| Address |
No. 51 Chongfu Road,Nanjing Chemical Industrial Park,Nanjing City 210047,China |