73-40-5 Guanine
| product Name |
Guanine |
| CAS No |
73-40-5 |
| Synonyms |
C.I. 75170; C.I. Natural White 1; 2-Amino-1,7-Dihydro-6H-Purin-6-One; 2-Aminohypoxanthine; 2-Amino-6-Hydroxypurine; 2-Amino-3,7-Dihydro-6H-Purin-6-One; 6-Hydroxy-2-Aminopurine; 6-N-Hydroxyaminopurine; Akos B019969; 2-Amino-1,9-Dihydro-Purin-6-One; 2-Amino-6-Purinol;
|
| Molecular Formula |
C5H5N5O |
| Molecular Weight |
151.1261 |
| InChI |
InChI=1/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11) |
| EINECS |
200-799-8 |
| Molecular Structure |
|
| Density |
2.19g/cm3 |
| Melting point |
360℃ |
| Boiling point |
591.4°C at 760 mmHg |
| Refractive index |
2.047 |
| Flash point |
311.4°C |
| Water solubility |
practically insoluble |
| Vapour Pressur |
5.86E-14mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-311-86136559 |
| Email |
sales@hbmedipharm.com |
| Address |
NO.158 Zhongshan E. Rd., Binjiang Commercial Building A 11 Floor,Shijiazhuang Hebei China. |
| Description |
1.Product name??Guanine Alias: guano, guanopine, 2-amino-6-hydroxypurine, 2-aminohypoxanthine 2.Product name??Guanine Alias??Gua; Guanin; Guanie; dewpearl 3.CAS No.:73-40-5 4. Molecular formula: C5H5N5O 5. Molecular weight: 151.13 6. Executive standards: 7. Packing: 8. Physical and chemical properties: white to light yellow crystal powder. Soluble in acids and bases, slightly soluble in ethanol and ether, insoluble in water. 9.Uses: used as an intermediate of antiviral drug acyclovir. Intermediate of sulfur Guanine and open-ring Guanine. |
| Contact |
Mr. Lv |
| Telephone |
+86-377-68139999 |
| Email |
15290390896@139.com |
| Address |
East Section of Logistics Road, Anpeng Chemical Industry Cluster, Tongbai County, Henan Province, China |
| Telephone |
+86-571-88383188;86970388;+49-211-550203-21 |
| Email |
sales@dragon-chem.com |
| Address |
16/Fl., Tower B, Qingchun Development Building, 66 East Qingchun Rd., Hangzhou, China |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Jianhui |
| Telephone |
0311-86137605 86137607 |
| Email |
cinchem@heinfo.net |
| Address |
Huai An East Road, Shijiazhuang City, Hebei Province, No. 28 |