ChemNet > CAS > 72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
| product Name |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
| CAS No |
72-55-9 |
| Synonyms |
p,p-DDE |
| Molecular Formula |
C14H8Cl4 |
| Molecular Weight |
318.02 |
| InChI |
InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
| EINECS |
200-784-6 |
| Molecular Structure |
|
| Melting point |
87-90℃ |
| Water solubility |
0.00000013 g/100 mL |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R33:Danger of cummulative effects.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|