6949-73-1 2-Hydroxy-9-fluorenone
| product Name |
2-Hydroxy-9-fluorenone |
| CAS No |
6949-73-1 |
| Synonyms |
2-Hydroxyfluoren-9-one; NSC 22835; 2-hydroxy-9H-fluoren-9-one |
| Molecular Formula |
C13H8O2 |
| Molecular Weight |
196.2014 |
| InChI |
InChI=1/C13H8O2/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8/h1-7,14H |
| EINECS |
230-119-5 |
| Molecular Structure |
|
| Density |
1.369g/cm3 |
| Melting point |
202-207℃ |
| Boiling point |
386.6°C at 760 mmHg |
| Refractive index |
1.707 |
| Flash point |
165.1°C |
| Vapour Pressur |
1.57E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|