ChemNet > CAS > 300-85-6 DL-3-Hydroxy-n-butyric Acid
300-85-6 DL-3-Hydroxy-n-butyric Acid
| product Name |
DL-3-Hydroxy-n-butyric Acid |
| CAS No |
300-85-6;625-71-8 |
| Synonyms |
3-Hydroxybutyric acid; dl-B-hydroxybutyric acid; (3R)-3-hydroxybutanoate; DL-3-Hydroxybutanoic acid |
| Molecular Formula |
C4H8O3 |
| Molecular Weight |
104.1 |
| InChI |
InChI=1/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1/t3-/m1/s1 |
| Molecular Structure |
|
| Density |
1.126 |
| Boiling point |
118-120℃ (2 mmHg) |
| Refractive index |
1.443 |
| Flash point |
>110℃ |
| Vapour Pressur |
0.000979mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
Featured China Suppliers
| Contact |
Mr. Wei |
| Telephone |
+86-573-82813637;82813639 |
| Email |
sales@jlightchem.com |
| Address |
Dongtang slip, Jiaxing Industrial Park, Daqiao Town, Jiaxing, Zhejiang, China. |