14309-57-0 3-Nonen-2-one
| product Name |
3-Nonen-2-one |
| CAS No |
14309-57-0 |
| Synonyms |
non-3-en-2-one; (3E)-non-3-en-2-one; (3Z)-non-3-en-2-one |
| Molecular Formula |
C9H16O |
| Molecular Weight |
140.2227 |
| InChI |
InChI=1/C9H16O/c1-3-4-5-6-7-8-9(2)10/h7-8H,3-6H2,1-2H3/b8-7- |
| EINECS |
238-248-9 |
| Molecular Structure |
|
| Density |
0.835g/cm3 |
| Boiling point |
201.9°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
81.3°C |
| Vapour Pressur |
0.301mmHg at 25°C |
| Risk Codes |
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr.Wang;Mr.Zhou |
| Telephone |
+86-574-87029709 |
| Email |
zhouwen@nbhuizhen.com |
| Address |
Building 6, Medical Equipment Intelligent Manufacturing Park, Ningbo South Binhai Development Zone, Liyang Town, Ninghai County, Ningbo City, Zhejiang Province |