ChemNet > CAS > 94602-04-7 4-Ethoxy-3-nitropyridine hydrochloride
94602-04-7 4-Ethoxy-3-nitropyridine hydrochloride
| Produkt-Name |
4-Ethoxy-3-nitropyridine hydrochloride |
| Englischer Name |
4-Ethoxy-3-nitropyridine hydrochloride; 3-Nitro-4-ethoxypyridine hydrochloride; 4-ethoxy-3-nitropyridine hydrochloride (1:1) |
| Molekulare Formel |
C7H9ClN2O3 |
| Molecular Weight |
204.611 |
| InChI |
InChI=1/C7H8N2O3.ClH/c1-2-12-7-3-4-8-5-6(7)9(10)11;/h3-5H,2H2,1H3;1H |
| CAS Registry Number |
94602-04-7 |
| Molecular Structure |
|
| Siedepunkt |
319.2°C at 760 mmHg |
| Flammpunkt |
146.8°C |
| Dampfdruck |
0.000252mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|