611-05-2 3-Methyl-4-nitroaniline
| název vyrobku |
3-Methyl-4-nitroaniline |
| Anglicky název |
3-Methyl-4-nitroaniline; 3-Amino-6-nitrotoluene~4-Nitro-m-toluidine; 4-Nitro-m-toluidine (NH2=1) |
| Molekulární vzorec |
C7H8N2O2 |
| Molekulová hmotnost |
152.1506 |
| InChI |
InChI=1/C7H8N2O2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,8H2,1H3 |
| Registra?ní ?íslo CAS |
611-05-2 |
| EINECS |
210-247-8 |
| Molekulární struktura |
|
| Hustota |
1.269g/cm3 |
| Bod varu |
330°C at 760 mmHg |
| Index lomu |
1.615 |
| Bod vzplanutí |
153.4°C |
| Tlak par |
0.000171mmHg at 25°C |
| Riziko Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Bezpe?nostní Popis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|