ChemNet > CAS > 5653-62-3 2,3-Dimethoxybenzonitrile
5653-62-3 2,3-Dimethoxybenzonitrile
| název vyrobku |
2,3-Dimethoxybenzonitrile |
| Anglicky název |
2,3-Dimethoxybenzonitrile;Benzonitrile, 2,3-dimethoxy-; 4-10-00-01418 (Beilstein Handbook Reference); BRN 2719631; NSC 27018; o-Veratronitrile (8CI) |
| Molekulární vzorec |
C9H9NO2 |
| Molekulová hmotnost |
163.17 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 |
| Registra?ní ?íslo CAS |
5653-62-3 |
| EINECS |
227-097-4 |
| Molekulární struktura |
|
| Bod tání |
41-46℃ |
| Symbol? nebezpe?nosti |
Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpe?nostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|