56777-24-3 benzyl (S)-(-)-lactate
| product Name |
benzyl (S)-(-)-lactate |
| CAS No |
56777-24-3 |
| Synonyms |
Benzyl L-lactate; Benzyl (S)-2-hydroxypropionate; L-Lactic acid benzyl ester; (S)-(-)Lactic acid benzyl ester; benzyl (2S)-2-hydroxypropanoate |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-8(11)10(12)13-7-9-5-3-2-4-6-9/h2-6,8,11H,7H2,1H3/t8-/m0/s1 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Boiling point |
280.482°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
116.76°C |
| Vapour Pressur |
0.002mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |