504-02-9 1,3-Cyclohexanedione
| product Name |
1,3-Cyclohexanedione |
| CAS No |
504-02-9 |
| Synonyms |
Dihydroresorcinol; 1,3-cycloadipicketone; 1,3-Dioxocyclohexane; Cyclohexane-1,3-dione; 3-hydroxycyclohex-2-en-1-one; Resorcinol, dihydro-; 1,3-Cyclohexandione |
| Molecular Formula |
C6H8O2 |
| Molecular Weight |
112.1265 |
| InChI |
InChI=1/C6H8O2/c7-5-2-1-3-6(8)4-5/h4,7H,1-3H2 |
| EINECS |
207-980-0 |
| Molecular Structure |
|
| Density |
1.229g/cm3 |
| Melting point |
101-105℃ |
| Boiling point |
222.7°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
89.6°C |
| Water solubility |
soluble |
| Vapour Pressur |
0.0204mmHg at 25°C |
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Ruby Yin |
| Telephone |
86-578-8185786 |
| Email |
sales@rongkaichem.com |
| Address |
Shangjiang Industrial Zone, Suichang, Zhejiang, China |
| Contact |
Manager Lin |
| Telephone |
+86-592-6519005 |
| Email |
U-FREE2018@ufreechem.com |
| Address |
Unit 01, 3rd Floor, No. 120 Xinyuan Road, Haicang District, Xiamen, China |
| Contact |
Miss ying |
| Telephone |
+86-571-86589381;86589382;86589383 |
| Email |
sales@qqpharm.com |
| Address |
No.3 Chuancheng South road,Xianju,Zhejiang,China |
| Contact |
Ms linli |
| Telephone |
+86-13958038112 |
| Email |
13958038112@139.com |
| Address |
RM6421 of North Building of Zhijiang Hotel, 188-200 Moganshan Road, Hangzhou, 310005, China |
| Contact |
Manager Li |
| Telephone |
+86-27-83840107 83315581 83315582 |
| Email |
sales@chemax.com.cn |
| Address |
3-208 No.17 The 5th Gutian Road Qiaokou District, Wuhan City,Hubei Province |