Details for Homophthalic Anhydride

Homophthalic Anhydride
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
703-59-3 |
| EC NO: |
211-873-4 |
| Molecular Formula: |
C9H6O3 |
| Molecular Weight: |
162.1421 |
| Specification: |
|
| InChI: |
InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
Product description:
APPLICATION
As speciality chemicals, in research chemicals, For further synthesis.
|
| Synonyms: |
1,3-Isochromandione;benzoglutaric anhydride;1H-isochromene-1,3(4H)-dione;o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione; |
| Molecular Structure: |
 |
if you are sourcing Homophthalic Anhydride from India ,just feel free to inquire