Details for Para Anisic Alcohol

Para Anisic Alcohol
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
105-13-5 |
| EC NO: |
203-273-6 |
| Molecular Formula: |
C8H10O2 |
| Molecular Weight: |
138.1638 |
| Specification: |
|
| InChI: |
InChI=1/C8H10O2/c1-10-8-4-2-7(6-9)3-5-8/h2-5,9H,6H2,1H3 |
| Synonyms: |
P-Anise Alcohol;P-Anisyl Alcohol;Anis;Anisy;Anisi;Benzenemethanol, 4-Methoxy-;4-Anise Alcohol;4-Anisyl Alcohol;4-Anisic Alcohol;(4-Methoxyphenyl)Methanol;Anisic Alcohol;Anise Alcohol;Anis Alcohol;Methoxybenzyl Alcohol;Methoxybenzylalcohol(4-);Fema 2099;4-Methoxy-Benzenemethano;4-Methoxybenzenemethanol;4-Methoxy-Benzenemethanol;Benzenemethanol,4-Methoxy-;P-Methoxy-Benzyl Alcohol;4-Methoxy-1,3-Benzothiazol-2-Amine;Anisyl Alcohol;P-Methoxybenzyl Alcohol;4-Methoxylbenzyl alcohol;Para Anisic Alcohol;PAAL; |
| Molecular Structure: |
 |
if you are sourcing Para Anisic Alcohol from India ,just feel free to inquire