Details for Ruthenium

Ruthenium
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
7440-18-8 |
| EC NO: |
231-127-1 |
| Molecular Formula: |
Ru |
| Molecular Weight: |
204.6556 |
| Specification: |
|
| InChI: |
InChI=1/C11H9ClN2/c12-8-9-2-4-10(5-3-9)11-13-6-1-7-14-11/h1-7H,8H2 |
| Synonyms: |
Ruthenium;Ruthenium;RutheniumpowderNmeshpowder;Ruthenium on carbon meshgran;Rutheniumcarbon;Rutheniumo naluminaxpellets;Ruthenium on alumina powder;Ruthenium on carbon Angstroms powder;Ruthenium on carbon;Ruthenium-powder;Ruthenium-black;Ruthenium on carbon; |
| Molecular Structure: |
 |
if you are sourcing Ruthenium from Germany ,just feel free to inquire