Details for 3-O-Ethyl-L-ascorbic acid

3-O-Ethyl-L-ascorbic acid
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
86404-04-8 |
| EC NO: |
|
| Molecular Formula: |
C8H12O6 |
| Molecular Weight: |
204.1773 |
| Specification: |
|
| InChI: |
InChI=1/C8H12O6/c1-2-13-7-5(11)8(12)14-6(7)4(10)3-9/h4,6,9-11H,2-3H2,1H3/t4-,6+/m0/s1 |
| Synonyms: |
(5R)-5-[(1S)-1,2-Dihydroxyethyl]-4-ethoxy-3-hydroxy-5H-furan-2-one;Ethyl ascorbic acid;VC ethyl ether;vitamin C ethyl ether;3-O-Ethyl vitamin C ester;(5R)-5-[(1S)-1,2-dihydroxyethyl]-4-ethoxy-3-hydroxyfuran-2(5H)-one (non-preferred name);3-O-ETHYL ASCORBIC ACID; |
| Molecular Structure: |
 |
if you are sourcing 3-O-Ethyl-L-ascorbic acid from China ,just feel free to inquire