Details for Itaconic Acid

Itaconic Acid
| Category: |
Other Chemicals |
|
| CAS NO: |
97-65-4 |
| EC NO: |
202-599-6 |
| Molecular Formula: |
C5H6O4 |
| Molecular Weight: |
128.084 |
| Specification: |
|
| InChI: |
InChI=1/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9)/p-2 |
| Uses: |
It is used as a co-monomer for the production of polyacrylonitrile fibers. It can also be used in the preparation of plasticizers, lubricant additives, etc. |
| Synonyms: |
Methylenesuccinic acid;Methylenebutanedioic acid;2-methylidenebutanedioate; |
| Molecular Structure: |
 |
if you are sourcing Itaconic Acid from China ,just feel free to inquire