Details for 2-Chlorophenylacetylene

2-Chlorophenylacetylene
| Category: |
Intermediates/Synthesis material intermediates |
|
| CAS NO: |
873-31-4 |
| EC NO: |
|
| Molecular Formula: |
C8H5Cl |
| Molecular Weight: |
136.5783 |
| Specification: |
GC≥98.0% |
| InChI: |
InChI=1/C8H5Cl/c1-2-7-5-3-4-6-8(7)9/h1,3-6H |
| Packing: |
PTFE barrel or on request |
Product description:
Chemical Name: 2-Chlorophenylacetylene
CAS No. 873-31-4
Content: GC≥98.0%
Appearance: pale yellow to colorless transparent liquid;
Packing: PTFE barrel or on request;
Productivity: 1Tons/M
|
| Uses: |
liquid crystal intermediates, pharmaceutical intermediates |
| Synonyms: |
2-Chlorophenylacetylene; |
| Molecular Structure: |
 |
if you are sourcing 2-Chlorophenylacetylene from China ,just feel free to inquire