Details for 2-methyl-3-nitrophenylacetic acid

2-methyl-3-nitrophenylacetic acid
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
23876-15-5 |
| EC NO: |
|
| Molecular Formula: |
C9H9NO4 |
| Molecular Weight: |
195.1721 |
| Specification: |
|
| InChI: |
InChI=1/C9H9NO4/c1-6-7(5-9(11)12)3-2-4-8(6)10(13)14/h2-4H,5H2,1H3,(H,11,12) |
| Synonyms: |
Ropinirole Intermediate-1;2-Methyl-3-Nitrophenyl Acetic Acid;2-Methyl-3-Nitrophenylaceticacid;2-Methyl-3-Nitro Phenyl Acetic Acid;2-Methyl-3-Niitrophenylacetic Acid;2-Methyl-3-Nitrophenylacetic Acid;2-Methyl-3-Nitro-Benzeneacetic Acid;(3-Nitro-O-Tolyl)Acetic Acid;2-Methyl-3-nitrohenylacetic acid;Ropinirole Intermediate 1;(2-Methyl-3-nitro-phenyl)-acetic acid; |
| Molecular Structure: |
 |
if you are sourcing 2-methyl-3-nitrophenylacetic acid from China ,just feel free to inquire