year
| Category: | Intermediates/Pharmaceutical intermediates |
|
|
| CAS NO: | 1314-56-3 | ||
| EC NO: | 215-236-1 | ||
| Molecular Formula: | P2O5 | ||
| Molecular Weight: | 141.9445 | ||
| Specification: | |||
| InChI: | InChI=1/O5P2/c1-6(2)5-7(3)4 | ||
| Packing: | 20kg bags or 50kg paperboard drums | ||
| Product description: Synonyms: Phosphoric anhydrideCAS No.: 1314-56-3 Molecular Formula: O5P2 Packing: 20kg bags or 50kg paperboard drums Applications: A kind of basic chemical raw material. It can used in the synthesis of various Phosphorous chemicals used in various field. |
|||
| Uses: | A kind of basic chemical raw material. It can used in the synthesis of various Phosphorous chemicals used in various field. | ||
| Synonyms: | Phosphoric anhydride;Phosphorus(V) oxide;phosphorus pentoxidedessicant;Phosphorous Pentoxide;Phosphorus pentoxide 99+ % for analysis;diphosphorus pentaoxide;PhosphorusVoxideACSwhitepowder;Phosphorusoxidewhitepowder;Phosphoric Pentoxide;P2O5;tricyclo[3.3.1.1~3,7~]tetraphosphoxane 1,3,5,7-tetraoxide;1,3-dioxodiphosphoxane-1,3-diium-1,3-diolate;Phosphorus(Ⅴ)oxide;Phosphorous Pentoxide (P2O5); | ||
| Molecular Structure: |
![]() |
||