| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
482-89-3 |
| EC NO: |
207-586-9 |
| Molecular Formula: |
C16H10N2O2 |
| Molecular Weight: |
262.2628 |
| Specification: |
|
| InChI: |
InChI=1/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H |
| Packing: |
In 25kg plastic woven bags. One 20'FCL loads 12mt without pallets. |
Product description:
| Item |
Index |
Content%≥ |
94 |
Moisture Content%≤ |
1.5 |
Particle Size% (-100 mesh) ≥ |
60 |
Fe content ppm≤ |
200 |
Dissolving Time (20癈) S≤ |
40 |
|
| Uses: |
Dye for Denim |
| Usage: |
As dyestuff and mainly used to dye cotton yarn, cotton fabrics, wool, silk cloth and etc. |
| Synonyms: |
C.I. 73000;C.I. Vat Blue 1;2-(1,3-Dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro-3H-indol-3-one;2,2'-Bis(2,3-dihydro-3-oxoindolylidene);Indigo blue;Vat Blue 1;2,2'-biindole-3,3'(1H,1'H)-dione; |
| Molecular Structure: |
 |