| Category: |
Catalyst and Auxiliary/Textile Auxiliary Agent |
|
| CAS NO: |
5026-62-0 |
| EC NO: |
225-714-1 |
| Molecular Formula: |
C8H7NaO3 |
| Molecular Weight: |
174.1291 |
| Specification: |
|
| InChI: |
InChI=1/C8H8O3.Na/c1-11-8(10)6-2-4-7(9)5-3-6;/h2-5,9H,1H3;/q;+1/p-1 |
| Packing: |
25kg in laminated aluminium film bag lined cardboard drum. |
| Uses: |
It is water soluble antiseptic, with the features of security, high efficiency and broad-spectrum. Widely used in pharmaceutical industry; food industry; textile. or used in the preservation of cosmetics, feed and daily products. |
| Synonyms: |
Methyl paraben,sodium salt;Methyl 4-hydroxybenzoate sodium salt;SODIUM METHYL PARABEN;Methyl Paraben Sodium;Sodium Methyl P-Hydroxybenzoate;sodium 4-(methoxycarbonyl)phenolate;Methyl 4-hydroxybenzoate sodium; |
| Molecular Structure: |
 |