Details for 2-Butoxyethyl Acetate

2-Butoxyethyl Acetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
112-07-2 |
| EC NO: |
203-933-3 |
| Molecular Formula: |
C8H18O3 |
| Molecular Weight: |
160.21324 |
| Specification: |
|
| InChI: |
InChI=1/C6H12O2.C2H6O2/c1-3-4-5-8-6(2)7;3-1-2-4/h3-5H2,1-2H3;3-4H,1-2H2 |
| Synonyms: |
Ethylene Glylol Butylether Acetate;Acetic Acid 2-Butoxyethyl Ester;1-Acetoxy-2-Butoxyethane;2-N-Butoxyethyl Acetate;Ethylene Glycol Monobutyl Ether Acetate;Ethyleneglycol Monobutyl Ester Acetate;Ethylene Glycol Mono-N-Butyl Ether Acetate;Ethylene Glycol Butyl Ether Acetate;Ethylene Glycol Monobutyl Ether Acetate(Bac);Butyl Acetate-Ethane-1,2-Diol (1:1);Bac;BGA; |
| Molecular Structure: |
 |
if you are sourcing 2-Butoxyethyl Acetate from Canada ,just feel free to inquire